C30H37N3O4 — CID 58593243
(3S,4R,5R)-2-[[2-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[2-(1H-indol-3-yl)ethyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 58593243) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is (3S,4R,5R)-2-[[2-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[2-(1H-indol-3-yl)ethyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4R,5R)-2-[[2-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[2-(1H-indol-3-yl)ethyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 58593243 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (3S,4R,5R)-2-[[2-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[2-(1H-indol-3-yl)ethyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | C[C@H](O)[C@@H]1[C@H](CO)ON(Cc2ccccc2C#CC(C)(C)C)[C@@H]1C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H37N3O4/c1-20(35)27-26(19-34)37-33(18-23-10-6-5-9-21(23)13-15-30(2,3)4)28(27)29(36)31-16-14-22-17-32-25-12-8-7-11-24(22)25/h5-12,17,20,26-28,32,34-35H,14,16,18-19H2,1-4H3,(H,31,36)/t20-,26-,27+,28-/m0/s1 |
| InChIKey | OVLIFSBHOQPGBB-LXYWRUMBSA-N |
| XLogP | 3.40 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|