C32H47NO4Si — CID 58593270
(3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[[4-[2-(cyclohexen-1-yl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 58593270) has the molecular formula C32H47NO4Si and a molecular weight of 537.82 g/mol. Its IUPAC name is (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[[4-[2-(cyclohexen-1-yl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[[4-[2-(cyclohexen-1-yl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 58593270 |
| Molecular Formula | C32H47NO4Si |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[[4-[2-(cyclohexen-1-yl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | CCCC[Si](O[C@H](C)[C@@H]1ON(Cc2ccc(C#CC3=CCCCC3)cc2)[C@H]2C(=O)OC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H47NO4Si/c1-7-8-20-38(23(2)3,24(4)5)37-25(6)31-29-22-35-32(34)30(29)33(36-31)21-28-18-16-27(17-19-28)15-14-26-12-10-9-11-13-26/h12,16-19,23-25,29-31H,7-11,13,20-22H2,1-6H3/t25-,29-,30-,31+/m1/s1 |
| InChIKey | YFIJPYDFYYEYEY-DWNPXIOKSA-N |
| XLogP | 7.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|