C20H30INO4Si — CID 58593285
(3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 58593285) has the molecular formula C20H30INO4Si and a molecular weight of 503.45 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 58593285 |
| Molecular Formula | C20H30INO4Si |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1ON(Cc2ccc(I)cc2)[C@@H]2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C20H30INO4Si/c1-13(26-27(5,6)20(2,3)4)18-16-12-24-19(23)17(16)22(25-18)11-14-7-9-15(21)10-8-14/h7-10,13,16-18H,11-12H2,1-6H3/t13-,16-,17-,18-/m0/s1 |
| InChIKey | MKHUDYNRKIVUQD-MGHWNKPDSA-N |
| XLogP | 4.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|