C11H25N2O4P3 — CID 58593531
(2R)-N-(diphosphanyloxy)-4-phosphanyloxy-2-[[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]methyl]butanamide (PubChem CID 58593531) has the molecular formula C11H25N2O4P3 and a molecular weight of 342.25 g/mol. Its IUPAC name is (2R)-N-(diphosphanyloxy)-4-phosphanyloxy-2-[[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]methyl]butanamide.
| Compound Name | (2R)-N-(diphosphanyloxy)-4-phosphanyloxy-2-[[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 58593531 |
| Molecular Formula | C11H25N2O4P3 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2R)-N-(diphosphanyloxy)-4-phosphanyloxy-2-[[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]methyl]butanamide |
| SMILES | CN1[C@@H](C[C@H](CCOP)C(=O)NOPP)COC1(C)C |
| InChI | InChI=1S/C11H25N2O4P3/c1-11(2)13(3)9(7-15-11)6-8(4-5-16-18)10(14)12-17-20-19/h8-9,20H,4-7,18-19H2,1-3H3,(H,12,14)/t8-,9-/m0/s1 |
| InChIKey | CXTBYLHWKJYLCM-IUCAKERBSA-N |
| XLogP | 1.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|