C34H37F5N2O2 — CID 58594348
(3S)-5-(2,6-difluorophenyl)-N,N-dipentyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole-3-carboxamide (PubChem CID 58594348) has the molecular formula C34H37F5N2O2 and a molecular weight of 600.67 g/mol. Its IUPAC name is (3S)-5-(2,6-difluorophenyl)-N,N-dipentyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole-3-carboxamide.
| Compound Name | (3S)-5-(2,6-difluorophenyl)-N,N-dipentyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58594348 |
| Molecular Formula | C34H37F5N2O2 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | (3S)-5-(2,6-difluorophenyl)-N,N-dipentyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole-3-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H]1CC(c2c(F)cccc2F)=NC1c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H37F5N2O2/c1-3-5-7-20-41(21-8-6-4-2)33(42)27-22-30(31-28(35)10-9-11-29(31)36)40-32(27)25-14-12-23(13-15-25)24-16-18-26(19-17-24)43-34(37,38)39/h9-19,27,32H,3-8,20-22H2,1-2H3/t27-,32?/m0/s1 |
| InChIKey | NKUYDSLCVUVAJP-BSXJZHEVSA-N |
| XLogP | 9.29 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|