C23H44N2Si — CID 58594396
N-[(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilyl]-2-methylpropan-2-amine (PubChem CID 58594396) has the molecular formula C23H44N2Si and a molecular weight of 376.71 g/mol. Its IUPAC name is N-[(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilyl]-2-methylpropan-2-amine.
| Compound Name | N-[(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 58594396 |
| Molecular Formula | C23H44N2Si |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | N-[(2,5-dimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilyl]-2-methylpropan-2-amine |
| SMILES | CC1CCC2C(C1)C1C3CCCCC3C([Si](C)(C)NC(C)(C)C)C1N2C |
| InChI | InChI=1S/C23H44N2Si/c1-15-12-13-19-18(14-15)20-16-10-8-9-11-17(16)22(21(20)25(19)5)26(6,7)24-23(2,3)4/h15-22,24H,8-14H2,1-7H3 |
| InChIKey | IOHSJCZOFKZAHI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|