About (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol
(1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol (PubChem CID 58594585) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol |
| PubChem CID | 58594585 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol |
| SMILES | CN1CCC[C@H]1[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-10(2,3)9(12)8-6-5-7-11(8)4/h8-9,12H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | VEYUTOQVHVPIHN-DTWKUNHWSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol?
The IUPAC name of (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol (CID 58594585) is (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol.
What is the SMILES notation for (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol?
The canonical SMILES for (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol is CN1CCC[C@H]1[C@@H](O)C(C)(C)C.
What is the InChIKey of (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol?
The InChIKey is VEYUTOQVHVPIHN-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H21NO/c1-10(2,3)9(12)8-6-5-7-11(8)4/h8-9,12H,5-7H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol?
(1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol has a molecular weight of 171.28 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-dimethyl-1-[(2S)-1-methylpyrrolidin-2-yl]propan-1-ol is sourced from PubChem (CID 58594585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).