C20H30 — CID 585949
1,2,3,4,5-pentamethyl-5-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene (PubChem CID 585949) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-5-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentamethyl-5-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 585949 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-5-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)(C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C20H30/c1-11-12(2)16(6)19(9,15(11)5)20(10)17(7)13(3)14(4)18(20)8/h1-10H3 |
| InChIKey | HMNLFPWFUBQOIB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |