C11H24O4S2 — CID 585952
6,6-bis(ethylsulfanyl)-4-methylhexane-1,2,3,5-tetrol (PubChem CID 585952) has the molecular formula C11H24O4S2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 6,6-bis(ethylsulfanyl)-4-methylhexane-1,2,3,5-tetrol.
| Compound Name | 6,6-bis(ethylsulfanyl)-4-methylhexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 585952 |
| Molecular Formula | C11H24O4S2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6,6-bis(ethylsulfanyl)-4-methylhexane-1,2,3,5-tetrol |
| SMILES | CCSC(SCC)C(O)C(C)C(O)C(O)CO |
| InChI | InChI=1S/C11H24O4S2/c1-4-16-11(17-5-2)10(15)7(3)9(14)8(13)6-12/h7-15H,4-6H2,1-3H3 |
| InChIKey | UWNJWPYFQCBHAZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|