C25H17N7O3 — CID 58595442
(1R,6R)-4-(8-cyanoquinolin-5-yl)-N-(4-isocyanophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 58595442) has the molecular formula C25H17N7O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is (1R,6R)-4-(8-cyanoquinolin-5-yl)-N-(4-isocyanophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | (1R,6R)-4-(8-cyanoquinolin-5-yl)-N-(4-isocyanophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 58595442 |
| Molecular Formula | C25H17N7O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (1R,6R)-4-(8-cyanoquinolin-5-yl)-N-(4-isocyanophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)N2C[C@H]3CC2[C@@H]2C(=O)N(c4ccc(C#N)c5ncccc45)C(=O)N32)cc1 |
| InChI | InChI=1S/C25H17N7O3/c1-27-15-5-7-16(8-6-15)29-24(34)30-13-17-11-20(30)22-23(33)32(25(35)31(17)22)19-9-4-14(12-26)21-18(19)3-2-10-28-21/h2-10,17,20,22H,11,13H2,(H,29,34)/t17-,20?,22-/m1/s1 |
| InChIKey | WYIUVRUIQBGPAV-IOVLZCAISA-N |
| XLogP | 3.48 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|