About 2-hydroxy-1,3,2-benzodioxaborole
2-hydroxy-1,3,2-benzodioxaborole (PubChem CID 585956) has the molecular formula C6H5BO3
and a molecular weight of 135.91 g/mol. Its IUPAC name is 2-hydroxy-1,3,2-benzodioxaborole.
Molecular Properties
| Compound Name | 2-hydroxy-1,3,2-benzodioxaborole |
| PubChem CID | 585956 |
| Molecular Formula | C6H5BO3 |
| Molecular Weight | 135.91 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 2-hydroxy-1,3,2-benzodioxaborole |
| SMILES | OB1Oc2ccccc2O1 |
| InChI | InChI=1S/C6H5BO3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4,8H |
| InChIKey | OOFDANOLKKSIGY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.91 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-1,3,2-benzodioxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,3,2-benzodioxaborole?
The IUPAC name of 2-hydroxy-1,3,2-benzodioxaborole (CID 585956) is 2-hydroxy-1,3,2-benzodioxaborole.
What is the SMILES notation for 2-hydroxy-1,3,2-benzodioxaborole?
The canonical SMILES for 2-hydroxy-1,3,2-benzodioxaborole is OB1Oc2ccccc2O1.
What is the InChIKey of 2-hydroxy-1,3,2-benzodioxaborole?
The InChIKey is OOFDANOLKKSIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BO3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4,8H.
What are the key properties of 2-hydroxy-1,3,2-benzodioxaborole?
2-hydroxy-1,3,2-benzodioxaborole has a molecular weight of 135.91 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3,2-benzodioxaborole is sourced from PubChem (CID 585956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).