C17H12ClF3N4O3 — CID 58595619
2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile (PubChem CID 58595619) has the molecular formula C17H12ClF3N4O3 and a molecular weight of 412.76 g/mol. Its IUPAC name is 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 58595619 |
| Molecular Formula | C17H12ClF3N4O3 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-chloro-4-[(1R,6R)-3,5-dioxo-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decan-4-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)[C@H]3C4C[C@H](CN4C(=O)C(F)(F)F)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C17H12ClF3N4O3/c1-7-10(3-2-8(5-22)12(7)18)25-14(26)13-11-4-9(24(13)16(25)28)6-23(11)15(27)17(19,20)21/h2-3,9,11,13H,4,6H2,1H3/t9-,11?,13-/m1/s1 |
| InChIKey | XWJQEZMSPYTHQI-QSOGALPCSA-N |
| XLogP | 2.20 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|