C16H15N5O4 — CID 58595705
methyl (1R,6R)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 58595705) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is methyl (1R,6R)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | methyl (1R,6R)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 58595705 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl (1R,6R)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COC(=O)N1C[C@H]2CC1[C@@H]1C(=O)N(c3cnc(C#N)c(C)c3)C(=O)N21 |
| InChI | InChI=1S/C16H15N5O4/c1-8-3-9(6-18-11(8)5-17)21-14(22)13-12-4-10(20(13)15(21)23)7-19(12)16(24)25-2/h3,6,10,12-13H,4,7H2,1-2H3/t10-,12?,13-/m1/s1 |
| InChIKey | GDTWRWNYUFZZKM-SJMSNRFBSA-N |
| XLogP | 0.62 |
| TPSA | 106.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|