C32H56N8O3S — CID 58595859
3-[[(4S,9R,14S,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]propyl N-[6-(carbamoylamino)hexyl]carbamate (PubChem CID 58595859) has the molecular formula C32H56N8O3S and a molecular weight of 632.92 g/mol. Its IUPAC name is 3-[[(4S,9R,14S,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]propyl N-[6-(carbamoylamino)hexyl]carbamate.
| Compound Name | 3-[[(4S,9R,14S,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]propyl N-[6-(carbamoylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 58595859 |
| Molecular Formula | C32H56N8O3S |
| Molecular Weight | 632.92 g/mol |
| Exact Mass | 632.42 |
| IUPAC Name | 3-[[(4S,9R,14S,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]propyl N-[6-(carbamoylamino)hexyl]carbamate |
| SMILES | NC(=O)NCCCCCCNC(=O)OCCCSc1cc2nc(c1)CN[C@@H]1CCCC[C@@H]1NCCN[C@@H]1CCCC[C@@H]1NC2 |
| InChI | InChI=1S/C32H56N8O3S/c33-31(41)36-14-7-1-2-8-15-37-32(42)43-18-9-19-44-26-20-24-22-38-29-12-5-3-10-27(29)34-16-17-35-28-11-4-6-13-30(28)39-23-25(21-26)40-24/h20-21,27-30,34-35,38-39H,1-19,22-23H2,(H,37,42)(H3,33,36,41)/t27-,28+,29+,30- |
| InChIKey | YRGWVVHDZBFJBB-LPOKLPNDSA-N |
| XLogP | 3.51 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|