About 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium
4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium (PubChem CID 58596100) has the molecular formula C10H9O5Y-
and a molecular weight of 298.08 g/mol. Its IUPAC name is 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium.
Molecular Properties
| Compound Name | 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium |
| PubChem CID | 58596100 |
| Molecular Formula | C10H9O5Y- |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium |
| SMILES | COC(=O)Oc1ccc(C(=O)O)[c-]c1C.[Y] |
| InChI | InChI=1S/C10H9O5.Y/c1-6-5-7(9(11)12)3-4-8(6)15-10(13)14-2;/h3-4H,1-2H3,(H,11,12);/q-1; |
| InChIKey | DRZBHEUQAGCEKJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium?
The IUPAC name of 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium (CID 58596100) is 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium.
What is the SMILES notation for 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium?
The canonical SMILES for 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium is COC(=O)Oc1ccc(C(=O)O)[c-]c1C.[Y].
What is the InChIKey of 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium?
The InChIKey is DRZBHEUQAGCEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O5.Y/c1-6-5-7(9(11)12)3-4-8(6)15-10(13)14-2;/h3-4H,1-2H3,(H,11,12);/q-1;.
What are the key properties of 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium?
4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium has a molecular weight of 298.08 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycarbonyloxy-3-methylbenzene-2-ide-1-carboxylic acid;yttrium is sourced from PubChem (CID 58596100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).