C30H29F6NO — CID 58596581
1'-hexyl-3',3'-dimethyl-6,8-bis(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] (PubChem CID 58596581) has the molecular formula C30H29F6NO and a molecular weight of 533.56 g/mol. Its IUPAC name is 1'-hexyl-3',3'-dimethyl-6,8-bis(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole].
| Compound Name | 1'-hexyl-3',3'-dimethyl-6,8-bis(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] |
|---|---|
| PubChem CID | 58596581 |
| Molecular Formula | C30H29F6NO |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 1'-hexyl-3',3'-dimethyl-6,8-bis(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] |
| SMILES | CCCCCCN1c2ccccc2C(C)(C)C12C=Cc1c(cc(C(F)(F)F)c3cc(C(F)(F)F)ccc13)O2 |
| InChI | InChI=1S/C30H29F6NO/c1-4-5-6-9-16-37-25-11-8-7-10-23(25)27(2,3)28(37)15-14-21-20-13-12-19(29(31,32)33)17-22(20)24(30(34,35)36)18-26(21)38-28/h7-8,10-15,17-18H,4-6,9,16H2,1-3H3 |
| InChIKey | UBSTYUABJKIXDD-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|