C27H26F3NO3 — CID 58596608
5',6'-dimethoxy-1',3',3',9-tetramethyl-8-(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] (PubChem CID 58596608) has the molecular formula C27H26F3NO3 and a molecular weight of 469.50 g/mol. Its IUPAC name is 5',6'-dimethoxy-1',3',3',9-tetramethyl-8-(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole].
| Compound Name | 5',6'-dimethoxy-1',3',3',9-tetramethyl-8-(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] |
|---|---|
| PubChem CID | 58596608 |
| Molecular Formula | C27H26F3NO3 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5',6'-dimethoxy-1',3',3',9-tetramethyl-8-(trifluoromethyl)spiro[benzo[f]chromene-3,2'-indole] |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C1(C=Cc3c(ccc4cc(C(F)(F)F)c(C)cc34)O1)N2C |
| InChI | InChI=1S/C27H26F3NO3/c1-15-11-18-16(12-19(15)27(28,29)30)7-8-22-17(18)9-10-26(34-22)25(2,3)20-13-23(32-5)24(33-6)14-21(20)31(26)4/h7-14H,1-6H3 |
| InChIKey | WBMYSJSQWZCVIP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|