C9H16Cl3O2P — CID 58596716
3-[but-3-enoxy(chloro)phosphoryl]-1,5-dichloropentane (PubChem CID 58596716) has the molecular formula C9H16Cl3O2P and a molecular weight of 293.56 g/mol. Its IUPAC name is 3-[but-3-enoxy(chloro)phosphoryl]-1,5-dichloropentane.
| Compound Name | 3-[but-3-enoxy(chloro)phosphoryl]-1,5-dichloropentane |
|---|---|
| PubChem CID | 58596716 |
| Molecular Formula | C9H16Cl3O2P |
| Molecular Weight | 293.56 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-[but-3-enoxy(chloro)phosphoryl]-1,5-dichloropentane |
| SMILES | C=CCCOP(=O)(Cl)C(CCCl)CCCl |
| InChI | InChI=1S/C9H16Cl3O2P/c1-2-3-8-14-15(12,13)9(4-6-10)5-7-11/h2,9H,1,3-8H2 |
| InChIKey | AWSQTXULFRESQQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|