C35H42N12O7 — CID 58596740
1,3-bis[2-[2-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethyl]urea (PubChem CID 58596740) has the molecular formula C35H42N12O7 and a molecular weight of 742.80 g/mol. Its IUPAC name is 1,3-bis[2-[2-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethyl]urea.
| Compound Name | 1,3-bis[2-[2-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethyl]urea |
|---|---|
| PubChem CID | 58596740 |
| Molecular Formula | C35H42N12O7 |
| Molecular Weight | 742.80 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | 1,3-bis[2-[2-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethyl]urea |
| SMILES | Nc1nc(OCc2ccc(COCCOCCNC(=O)NCCOCCOCc3ccc(COc4nc(N)nc5nc[nH]c45)cc3)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C35H42N12O7/c36-33-44-29-27(40-21-42-29)31(46-33)53-19-25-5-1-23(2-6-25)17-51-15-13-49-11-9-38-35(48)39-10-12-50-14-16-52-18-24-3-7-26(8-4-24)20-54-32-28-30(43-22-41-28)45-34(37)47-32/h1-8,21-22H,9-20H2,(H2,38,39,48)(H3,36,40,42,44,46)(H3,37,41,43,45,47) |
| InChIKey | QYBCIYKUJHMKOR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 257.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|