About ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate
ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate (PubChem CID 58597067) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate |
| PubChem CID | 58597067 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate |
| SMILES | C=C/C=C(\C)[C@@H](CC)NC(=O)OCC |
| InChI | InChI=1S/C11H19NO2/c1-5-8-9(4)10(6-2)12-11(13)14-7-3/h5,8,10H,1,6-7H2,2-4H3,(H,12,13)/b9-8+/t10-/m1/s1 |
| InChIKey | LCHJFCVEJYRPAO-AAXQSMANSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate?
The IUPAC name of ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate (CID 58597067) is ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate.
What is the SMILES notation for ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate?
The canonical SMILES for ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate is C=C/C=C(\C)[C@@H](CC)NC(=O)OCC.
What is the InChIKey of ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate?
The InChIKey is LCHJFCVEJYRPAO-AAXQSMANSA-N. The full InChI is InChI=1S/C11H19NO2/c1-5-8-9(4)10(6-2)12-11(13)14-7-3/h5,8,10H,1,6-7H2,2-4H3,(H,12,13)/b9-8+/t10-/m1/s1.
What are the key properties of ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate?
ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate has a molecular weight of 197.28 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3R,4E)-4-methylhepta-4,6-dien-3-yl]carbamate is sourced from PubChem (CID 58597067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).