C27H32N6O2Si — CID 58597233
N-[4-[4-amino-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-5,7-dimethyl-1,3-benzoxazol-2-amine (PubChem CID 58597233) has the molecular formula C27H32N6O2Si and a molecular weight of 500.68 g/mol. Its IUPAC name is N-[4-[4-amino-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-5,7-dimethyl-1,3-benzoxazol-2-amine.
| Compound Name | N-[4-[4-amino-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-5,7-dimethyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 58597233 |
| Molecular Formula | C27H32N6O2Si |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-[4-[4-amino-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-5,7-dimethyl-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(C)c2oc(Nc3ccc(-c4cn(COCC[Si](C)(C)C)c5ncnc(N)c45)cc3)nc2c1 |
| InChI | InChI=1S/C27H32N6O2Si/c1-17-12-18(2)24-22(13-17)32-27(35-24)31-20-8-6-19(7-9-20)21-14-33(16-34-10-11-36(3,4)5)26-23(21)25(28)29-15-30-26/h6-9,12-15H,10-11,16H2,1-5H3,(H,31,32)(H2,28,29,30) |
| InChIKey | FPPSHEDUQPENHQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|