C15H16F3NO2 — CID 58597261
2,2,2-trifluoro-1-[(7S)-7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl]ethanone (PubChem CID 58597261) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(7S)-7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(7S)-7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 58597261 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[(7S)-7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl]ethanone |
| SMILES | O=C(N1CCc2c(ccc3c2CCC[C@@H]3O)C1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO2/c16-15(17,18)14(21)19-7-6-10-9(8-19)4-5-12-11(10)2-1-3-13(12)20/h4-5,13,20H,1-3,6-8H2/t13-/m0/s1 |
| InChIKey | JRMAOKLIBFCIKX-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |