C12H14N4O7S2 — CID 58597584
4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide (PubChem CID 58597584) has the molecular formula C12H14N4O7S2 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide.
| Compound Name | 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58597584 |
| Molecular Formula | C12H14N4O7S2 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-1,1,3-trioxo-1,2-thiazole-5-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC2=C(C(N)=O)S(=O)(=O)NC2=O)c1O |
| InChI | InChI=1S/C12H14N4O7S2/c1-16(2)25(22,23)7-5-3-4-6(9(7)17)14-8-10(11(13)18)24(20,21)15-12(8)19/h3-5,14,17H,1-2H3,(H2,13,18)(H,15,19) |
| InChIKey | PFTCRYGPXWVYTI-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|