About 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine
1,2-bis(4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 585976) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
| PubChem CID | 585976 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(N)C(N)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15-16H,17-18H2,1-2H3 |
| InChIKey | ZWMPRHYHRAUVGY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine?
The IUPAC name of 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine (CID 585976) is 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine.
What is the SMILES notation for 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine?
The canonical SMILES for 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine is COc1ccc(C(N)C(N)c2ccc(OC)cc2)cc1.
What is the InChIKey of 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine?
The InChIKey is ZWMPRHYHRAUVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15-16H,17-18H2,1-2H3.
What are the key properties of 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine?
1,2-bis(4-methoxyphenyl)ethane-1,2-diamine has a molecular weight of 272.35 g/mol, XLogP of 2.40, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-methoxyphenyl)ethane-1,2-diamine is sourced from PubChem (CID 585976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).