C27H34N2O8Si — CID 58597817
4-[3-[[(3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]-3-nitrobenzoic acid (PubChem CID 58597817) has the molecular formula C27H34N2O8Si and a molecular weight of 542.66 g/mol. Its IUPAC name is 4-[3-[[(3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]-3-nitrobenzoic acid.
| Compound Name | 4-[3-[[(3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 58597817 |
| Molecular Formula | C27H34N2O8Si |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-[3-[[(3R,3aR,4S,6aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]-3-nitrobenzoic acid |
| SMILES | C[C@@H]1OC(=O)[C@@H]2[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)ON2Cc1cccc(-c2ccc(C(=O)O)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H34N2O8Si/c1-16-23-22(15-35-38(5,6)27(2,3)4)37-28(24(23)26(32)36-16)14-17-8-7-9-18(12-17)20-11-10-19(25(30)31)13-21(20)29(33)34/h7-13,16,22-24H,14-15H2,1-6H3,(H,30,31)/t16-,22-,23+,24-/m0/s1 |
| InChIKey | INKPNBXBTSRQJH-AGCMCZDNSA-N |
| XLogP | 5.03 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|