About (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine
(1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine (PubChem CID 58598201) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 58598201 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)C[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C10H22N2/c1-12(2)8-10(11)9-6-4-3-5-7-9/h9-10H,3-8,11H2,1-2H3/t10-/m1/s1 |
| InChIKey | IXMISKMRXSRNAV-SNVBAGLBSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine (CID 58598201) is (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine is CN(C)C[C@@H](N)C1CCCCC1.
What is the InChIKey of (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine?
The InChIKey is IXMISKMRXSRNAV-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H22N2/c1-12(2)8-10(11)9-6-4-3-5-7-9/h9-10H,3-8,11H2,1-2H3/t10-/m1/s1.
What are the key properties of (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine?
(1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexyl-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 58598201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).