C19H26N2O5 — CID 58598219
methyl (3S)-1-carbamoyl-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 58598219) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl (3S)-1-carbamoyl-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S)-1-carbamoyl-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 58598219 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl (3S)-1-carbamoyl-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(N)=O)CC1c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C19H26N2O5/c1-24-16-8-7-12(9-17(16)26-13-5-3-4-6-13)14-10-21(19(20)23)11-15(14)18(22)25-2/h7-9,13-15H,3-6,10-11H2,1-2H3,(H2,20,23)/t14?,15-/m1/s1 |
| InChIKey | IIBXETZKBWPFME-YSSOQSIOSA-N |
| XLogP | 2.28 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |