C39H54F6O5Si — CID 58598401
ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]pentanoate (PubChem CID 58598401) has the molecular formula C39H54F6O5Si and a molecular weight of 744.93 g/mol. Its IUPAC name is ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]pentanoate.
| Compound Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]pentanoate |
|---|---|
| PubChem CID | 58598401 |
| Molecular Formula | C39H54F6O5Si |
| Molecular Weight | 744.93 g/mol |
| Exact Mass | 744.36 |
| IUPAC Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]pentanoate |
| SMILES | CCOC(=O)C[C@H](CCc1ccc(C(CC)(CC)c2ccc(C#CC(OCOC)(C(F)(F)F)C(F)(F)F)c(C)c2)cc1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H54F6O5Si/c1-12-36(13-2,32-19-16-30(28(5)24-32)21-22-37(38(40,41)42,39(43,44)45)49-26-47-9)31-18-15-29(27(4)23-31)17-20-33(25-34(46)48-14-3)50-51(10,11)35(6,7)8/h15-16,18-19,23-24,33H,12-14,17,20,25-26H2,1-11H3/t33-/m0/s1 |
| InChIKey | DHQACMYOUYSHMI-XIFFEERXSA-N |
| XLogP | 10.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.93 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|