C37H37F6NO4 — CID 58598472
2-[5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]pentyl]isoindole-1,3-dione (PubChem CID 58598472) has the molecular formula C37H37F6NO4 and a molecular weight of 673.69 g/mol. Its IUPAC name is 2-[5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58598472 |
| Molecular Formula | C37H37F6NO4 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 673.26 |
| IUPAC Name | 2-[5-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]pentyl]isoindole-1,3-dione |
| SMILES | CCC(CC)(c1ccc(C#CC(O)(C(F)(F)F)C(F)(F)F)c(C)c1)c1ccc(OCCCCCN2C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C37H37F6NO4/c1-5-34(6-2,27-15-14-26(24(3)22-27)18-19-35(47,36(38,39)40)37(41,42)43)28-16-17-31(25(4)23-28)48-21-11-7-10-20-44-32(45)29-12-8-9-13-30(29)33(44)46/h8-9,12-17,22-23,47H,5-7,10-11,20-21H2,1-4H3 |
| InChIKey | VCEWQSGYODCHJY-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|