About 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate
7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate (PubChem CID 58598633) has the molecular formula C23H30N2O8
and a molecular weight of 462.50 g/mol. Its IUPAC name is 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate.
Molecular Properties
| Compound Name | 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate |
| PubChem CID | 58598633 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate |
| SMILES | O=C(CCCCCCN1C(=O)C=CC1=O)OCOC(=O)CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H30N2O8/c26-18-11-12-19(27)24(18)15-7-3-1-5-9-22(30)32-17-33-23(31)10-6-2-4-8-16-25-20(28)13-14-21(25)29/h11-14H,1-10,15-17H2 |
| InChIKey | MGOXSYVCBRHIII-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate?
The IUPAC name of 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate (CID 58598633) is 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate.
What is the SMILES notation for 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate?
The canonical SMILES for 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate is O=C(CCCCCCN1C(=O)C=CC1=O)OCOC(=O)CCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate?
The InChIKey is MGOXSYVCBRHIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O8/c26-18-11-12-19(27)24(18)15-7-3-1-5-9-22(30)32-17-33-23(31)10-6-2-4-8-16-25-20(28)13-14-21(25)29/h11-14H,1-10,15-17H2.
What are the key properties of 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate?
7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate has a molecular weight of 462.50 g/mol, XLogP of 1.78, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,5-dioxopyrrol-1-yl)heptanoyloxymethyl 7-(2,5-dioxopyrrol-1-yl)heptanoate is sourced from PubChem (CID 58598633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).