About 1-(ethenylcarbamoyl)-1,3-dimethylurea
1-(ethenylcarbamoyl)-1,3-dimethylurea (PubChem CID 58598634) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-(ethenylcarbamoyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(ethenylcarbamoyl)-1,3-dimethylurea |
| PubChem CID | 58598634 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1-(ethenylcarbamoyl)-1,3-dimethylurea |
| SMILES | C=CNC(=O)N(C)C(=O)NC |
| InChI | InChI=1S/C6H11N3O2/c1-4-8-6(11)9(3)5(10)7-2/h4H,1H2,2-3H3,(H,7,10)(H,8,11) |
| InChIKey | DTJRIAVZIWENFY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(ethenylcarbamoyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethenylcarbamoyl)-1,3-dimethylurea?
The IUPAC name of 1-(ethenylcarbamoyl)-1,3-dimethylurea (CID 58598634) is 1-(ethenylcarbamoyl)-1,3-dimethylurea.
What is the SMILES notation for 1-(ethenylcarbamoyl)-1,3-dimethylurea?
The canonical SMILES for 1-(ethenylcarbamoyl)-1,3-dimethylurea is C=CNC(=O)N(C)C(=O)NC.
What is the InChIKey of 1-(ethenylcarbamoyl)-1,3-dimethylurea?
The InChIKey is DTJRIAVZIWENFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-4-8-6(11)9(3)5(10)7-2/h4H,1H2,2-3H3,(H,7,10)(H,8,11).
What are the key properties of 1-(ethenylcarbamoyl)-1,3-dimethylurea?
1-(ethenylcarbamoyl)-1,3-dimethylurea has a molecular weight of 157.17 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethenylcarbamoyl)-1,3-dimethylurea is sourced from PubChem (CID 58598634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).