C12H12O5 — CID 58599577
methyl 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl)acetate (PubChem CID 58599577) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is methyl 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl)acetate.
| Compound Name | methyl 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl)acetate |
|---|---|
| PubChem CID | 58599577 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | methyl 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl)acetate |
| SMILES | COC(=O)CC1=CC2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C12H12O5/c1-16-8(13)4-5-2-6-3-7(5)10-9(6)11(14)17-12(10)15/h2,6-7,9-10H,3-4H2,1H3 |
| InChIKey | ATEYIKOHMSZJOB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|