C14H14F4KNO2 — CID 58599711
potassium (2S)-4-fluoro-4-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]pentanoate (PubChem CID 58599711) has the molecular formula C14H14F4KNO2 and a molecular weight of 343.36 g/mol. Its IUPAC name is potassium (2S)-4-fluoro-4-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]pentanoate.
| Compound Name | potassium (2S)-4-fluoro-4-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]pentanoate |
|---|---|
| PubChem CID | 58599711 |
| Molecular Formula | C14H14F4KNO2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | potassium (2S)-4-fluoro-4-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]pentanoate |
| SMILES | CC(C)(F)C[C@H](/N=C(\c1ccccc1)C(F)(F)F)C(=O)[O-].[K+] |
| InChI | InChI=1S/C14H15F4NO2.K/c1-13(2,15)8-10(12(20)21)19-11(14(16,17)18)9-6-4-3-5-7-9;/h3-7,10H,8H2,1-2H3,(H,20,21);/q;+1/p-1/b19-11+;/t10-;/m0./s1 |
| InChIKey | SGOACBJTMYLLNY-FNORUERLSA-M |
| XLogP | -0.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|