About potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate
potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate (PubChem CID 58599713) has the molecular formula C13H13F3KNO2
and a molecular weight of 311.34 g/mol. Its IUPAC name is potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate.
Molecular Properties
| Compound Name | potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate |
| PubChem CID | 58599713 |
| Molecular Formula | C13H13F3KNO2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate |
| SMILES | CC(C)[C@H](/N=C(/c1ccccc1)C(F)(F)F)C(=O)[O-].[K+] |
| InChI | InChI=1S/C13H14F3NO2.K/c1-8(2)10(12(18)19)17-11(13(14,15)16)9-6-4-3-5-7-9;/h3-8,10H,1-2H3,(H,18,19);/q;+1/p-1/b17-11-;/t10-;/m0./s1 |
| InChIKey | IFRKRYNSZOPPEX-BZLNPMDQSA-M |
| XLogP | -1.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate?
The IUPAC name of potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate (CID 58599713) is potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate.
What is the SMILES notation for potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate?
The canonical SMILES for potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate is CC(C)[C@H](/N=C(/c1ccccc1)C(F)(F)F)C(=O)[O-].[K+].
What is the InChIKey of potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate?
The InChIKey is IFRKRYNSZOPPEX-BZLNPMDQSA-M. The full InChI is InChI=1S/C13H14F3NO2.K/c1-8(2)10(12(18)19)17-11(13(14,15)16)9-6-4-3-5-7-9;/h3-8,10H,1-2H3,(H,18,19);/q;+1/p-1/b17-11-;/t10-;/m0./s1.
What are the key properties of potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate?
potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate has a molecular weight of 311.34 g/mol, XLogP of -1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S)-3-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoate is sourced from PubChem (CID 58599713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).