C18H19N3O4 — CID 58599960
6-methyl-2-[4-(methylamino)phenyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58599960) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-methyl-2-[4-(methylamino)phenyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-methyl-2-[4-(methylamino)phenyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58599960 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-methyl-2-[4-(methylamino)phenyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CNc1ccc(N2C(=O)C3CC4C(=O)N(C)C(=O)C4CC3C2=O)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-19-9-3-5-10(6-4-9)21-17(24)13-7-11-12(8-14(13)18(21)25)16(23)20(2)15(11)22/h3-6,11-14,19H,7-8H2,1-2H3 |
| InChIKey | FQOZYGVZJCHJKR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|