About 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine
2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine (PubChem CID 58600041) has the molecular formula C16H13N3S2
and a molecular weight of 311.44 g/mol. Its IUPAC name is 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine |
| PubChem CID | 58600041 |
| Molecular Formula | C16H13N3S2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine |
| SMILES | Cc1nc(Sc2ccccc2)nc(Sc2ccccc2)n1 |
| InChI | InChI=1S/C16H13N3S2/c1-12-17-15(20-13-8-4-2-5-9-13)19-16(18-12)21-14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | SYZMVKOXFPZMGE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine?
The IUPAC name of 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine (CID 58600041) is 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine.
What is the SMILES notation for 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine?
The canonical SMILES for 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine is Cc1nc(Sc2ccccc2)nc(Sc2ccccc2)n1.
What is the InChIKey of 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine?
The InChIKey is SYZMVKOXFPZMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3S2/c1-12-17-15(20-13-8-4-2-5-9-13)19-16(18-12)21-14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine?
2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine has a molecular weight of 311.44 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-bis(phenylsulfanyl)-1,3,5-triazine is sourced from PubChem (CID 58600041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).