C39H69N9O6 — CID 58600173
N-[(8S,15S)-6,20-bis[6-(methylamino)hexanoylamino]-3,10,17-trioxo-1,4,11-triazatetracyclo[16.3.0.04,8.011,15]henicosan-13-yl]-6-(methylamino)hexanamide (PubChem CID 58600173) has the molecular formula C39H69N9O6 and a molecular weight of 760.04 g/mol. Its IUPAC name is N-[(8S,15S)-6,20-bis[6-(methylamino)hexanoylamino]-3,10,17-trioxo-1,4,11-triazatetracyclo[16.3.0.04,8.011,15]henicosan-13-yl]-6-(methylamino)hexanamide.
| Compound Name | N-[(8S,15S)-6,20-bis[6-(methylamino)hexanoylamino]-3,10,17-trioxo-1,4,11-triazatetracyclo[16.3.0.04,8.011,15]henicosan-13-yl]-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 58600173 |
| Molecular Formula | C39H69N9O6 |
| Molecular Weight | 760.04 g/mol |
| Exact Mass | 759.54 |
| IUPAC Name | N-[(8S,15S)-6,20-bis[6-(methylamino)hexanoylamino]-3,10,17-trioxo-1,4,11-triazatetracyclo[16.3.0.04,8.011,15]henicosan-13-yl]-6-(methylamino)hexanamide |
| SMILES | CNCCCCCC(=O)NC1CC2C(=O)C[C@@H]3CC(NC(=O)CCCCCNC)CN3C(=O)C[C@@H]3CC(NC(=O)CCCCCNC)CN3C(=O)CN2C1 |
| InChI | InChI=1S/C39H69N9O6/c1-40-16-10-4-7-13-35(50)43-28-19-31-22-34(49)33-21-30(45-37(52)15-9-6-12-18-42-3)24-46(33)27-39(54)48-26-29(20-32(48)23-38(53)47(31)25-28)44-36(51)14-8-5-11-17-41-2/h28-33,40-42H,4-27H2,1-3H3,(H,43,50)(H,44,51)(H,45,52)/t28?,29?,30?,31-,32-,33?/m0/s1 |
| InChIKey | FXFHAJWLQCGTKZ-PNIYNUOWSA-N |
| XLogP | 0.42 |
| TPSA | 184.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.04 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|