C21H31FO4S — CID 58600210
(2S,3S,4R,5R,6S)-2-(fluoromethyl)-6-[4-methyl-3-[(4-methylsulfanylcyclohexyl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 58600210) has the molecular formula C21H31FO4S and a molecular weight of 398.54 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-(fluoromethyl)-6-[4-methyl-3-[(4-methylsulfanylcyclohexyl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-(fluoromethyl)-6-[4-methyl-3-[(4-methylsulfanylcyclohexyl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58600210 |
| Molecular Formula | C21H31FO4S |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-(fluoromethyl)-6-[4-methyl-3-[(4-methylsulfanylcyclohexyl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | CSC1CCC(Cc2cc([C@@H]3O[C@H](CF)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)CC1 |
| InChI | InChI=1S/C21H31FO4S/c1-12-3-6-14(21-20(25)19(24)18(23)17(11-22)26-21)10-15(12)9-13-4-7-16(27-2)8-5-13/h3,6,10,13,16-21,23-25H,4-5,7-9,11H2,1-2H3/t13?,16?,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JGUTXOBIXMFOKL-DLUPIZGJSA-N |
| XLogP | 2.95 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |