About 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione
3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 58600236) has the molecular formula C17H17N2O5P
and a molecular weight of 360.31 g/mol. Its IUPAC name is 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione |
| PubChem CID | 58600236 |
| Molecular Formula | C17H17N2O5P |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COP(=O)(OC)N1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H17N2O5P/c1-23-25(22,24-2)19-15(20)17(18-16(19)21,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,18,21) |
| InChIKey | ODBVPGBCCJNTMU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione?
The IUPAC name of 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione (CID 58600236) is 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione.
What is the SMILES notation for 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione?
The canonical SMILES for 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione is COP(=O)(OC)N1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O.
What is the InChIKey of 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione?
The InChIKey is ODBVPGBCCJNTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N2O5P/c1-23-25(22,24-2)19-15(20)17(18-16(19)21,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,18,21).
What are the key properties of 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione?
3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione has a molecular weight of 360.31 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethoxyphosphoryl-5,5-diphenylimidazolidine-2,4-dione is sourced from PubChem (CID 58600236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).