C20H24NO3P — CID 58600253
methoxy-N-methyl-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]phosphonamidic acid (PubChem CID 58600253) has the molecular formula C20H24NO3P and a molecular weight of 357.39 g/mol. Its IUPAC name is methoxy-N-methyl-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]phosphonamidic acid.
| Compound Name | methoxy-N-methyl-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]phosphonamidic acid |
|---|---|
| PubChem CID | 58600253 |
| Molecular Formula | C20H24NO3P |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | methoxy-N-methyl-N-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]phosphonamidic acid |
| SMILES | COP(=O)(O)N(C)CCC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H24NO3P/c1-21(25(22,23)24-2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-12H,7,13-15H2,1-2H3,(H,22,23) |
| InChIKey | SEYKCMJJSRSBAI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|