C25H26NO3P — CID 58600406
phenoxy-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]phosphonamidic acid (PubChem CID 58600406) has the molecular formula C25H26NO3P and a molecular weight of 419.46 g/mol. Its IUPAC name is phenoxy-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]phosphonamidic acid.
| Compound Name | phenoxy-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]phosphonamidic acid |
|---|---|
| PubChem CID | 58600406 |
| Molecular Formula | C25H26NO3P |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | phenoxy-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]phosphonamidic acid |
| SMILES | O=P(O)(NCCCC12CCC(c3ccccc31)c1ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C25H26NO3P/c27-30(28,29-19-9-2-1-3-10-19)26-18-8-16-25-17-15-20(21-11-4-6-13-23(21)25)22-12-5-7-14-24(22)25/h1-7,9-14,20H,8,15-18H2,(H2,26,27,28) |
| InChIKey | CNNDERNGQHMAQY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|