C25H26FN4O3P — CID 58600456
[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-phenoxyphosphinic acid (PubChem CID 58600456) has the molecular formula C25H26FN4O3P and a molecular weight of 480.48 g/mol. Its IUPAC name is [4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-phenoxyphosphinic acid.
| Compound Name | [4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 58600456 |
| Molecular Formula | C25H26FN4O3P |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-phenoxyphosphinic acid |
| SMILES | O=P(O)(Oc1ccccc1)N1CCC(Nc2nc3ccccc3n2Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H26FN4O3P/c26-20-12-10-19(11-13-20)18-30-24-9-5-4-8-23(24)28-25(30)27-21-14-16-29(17-15-21)34(31,32)33-22-6-2-1-3-7-22/h1-13,21H,14-18H2,(H,27,28)(H,31,32) |
| InChIKey | PHUSKFZVOKGKHZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|