C10H11F3N2O2 — CID 58601029
(1R,3R,4S)-3-[(2,2,2-trifluoroacetyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 58601029) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is (1R,3R,4S)-3-[(2,2,2-trifluoroacetyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,3R,4S)-3-[(2,2,2-trifluoroacetyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 58601029 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (1R,3R,4S)-3-[(2,2,2-trifluoroacetyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1[C@H]2C=C[C@H](C2)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)9(17)15-7-5-2-1-4(3-5)6(7)8(14)16/h1-2,4-7H,3H2,(H2,14,16)(H,15,17)/t4-,5+,6?,7+/m0/s1 |
| InChIKey | WXOJSOGXERTEAK-NTIFKLMLSA-N |
| XLogP | 0.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|