C23H21F3N8O6 — CID 58601084
2-[[4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]-3-(trifluoromethoxy)benzoyl]amino]pentanedioic acid (PubChem CID 58601084) has the molecular formula C23H21F3N8O6 and a molecular weight of 562.47 g/mol. Its IUPAC name is 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]-3-(trifluoromethoxy)benzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]-3-(trifluoromethoxy)benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 58601084 |
| Molecular Formula | C23H21F3N8O6 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]-3-(trifluoromethoxy)benzoyl]amino]pentanedioic acid |
| SMILES | C#CCN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1OC(F)(F)F |
| InChI | InChI=1S/C23H21F3N8O6/c1-2-7-34(10-12-9-29-19-17(30-12)18(27)32-22(28)33-19)14-5-3-11(8-15(14)40-23(24,25)26)20(37)31-13(21(38)39)4-6-16(35)36/h1,3,5,8-9,13H,4,6-7,10H2,(H,31,37)(H,35,36)(H,38,39)(H4,27,28,29,32,33) |
| InChIKey | JXXDXDQMKMJNIP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 219.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|