C23H21N2S+ — CID 58601261
N-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine (PubChem CID 58601261) has the molecular formula C23H21N2S+ and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine.
| Compound Name | N-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 58601261 |
| Molecular Formula | C23H21N2S+ |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine |
| SMILES | CC[n+]1c(/C=C\C=C\Nc2ccc3ccccc3c2)sc2ccccc21 |
| InChI | InChI=1S/C23H20N2S/c1-2-25-21-11-5-6-12-22(21)26-23(25)13-7-8-16-24-20-15-14-18-9-3-4-10-19(18)17-20/h3-17H,2H2,1H3/p+1 |
| InChIKey | QMTLARPYQQSMQT-UHFFFAOYSA-O |
| XLogP | 6.00 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|