About ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate
ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate (PubChem CID 58601510) has the molecular formula C20H32N4O7
and a molecular weight of 440.50 g/mol. Its IUPAC name is ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate |
| PubChem CID | 58601510 |
| Molecular Formula | C20H32N4O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(CCNC(=O)CCN1C(=O)C=CC1=O)NC(=O)OCC |
| InChI | InChI=1S/C20H32N4O7/c1-3-30-19(28)22-12-6-5-7-15(23-20(29)31-4-2)10-13-21-16(25)11-14-24-17(26)8-9-18(24)27/h8-9,15H,3-7,10-14H2,1-2H3,(H,21,25)(H,22,28)(H,23,29) |
| InChIKey | OXUJQBSNIMJKPR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate?
The IUPAC name of ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate (CID 58601510) is ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate.
What is the SMILES notation for ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate?
The canonical SMILES for ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate is CCOC(=O)NCCCCC(CCNC(=O)CCN1C(=O)C=CC1=O)NC(=O)OCC.
What is the InChIKey of ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate?
The InChIKey is OXUJQBSNIMJKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N4O7/c1-3-30-19(28)22-12-6-5-7-15(23-20(29)31-4-2)10-13-21-16(25)11-14-24-17(26)8-9-18(24)27/h8-9,15H,3-7,10-14H2,1-2H3,(H,21,25)(H,22,28)(H,23,29).
What are the key properties of ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate?
ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate has a molecular weight of 440.50 g/mol, XLogP of 0.84, 14 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7-(ethoxycarbonylamino)heptan-3-yl]carbamate is sourced from PubChem (CID 58601510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).