C27H46O6Si — CID 58601691
methyl (1R,4aS,4bR,6R,8R,8aS,10aS)-8-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1,4a,6-trimethyl-10-oxo-3,4,4b,5,6,7,8,8a,9,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 58601691) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is methyl (1R,4aS,4bR,6R,8R,8aS,10aS)-8-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1,4a,6-trimethyl-10-oxo-3,4,4b,5,6,7,8,8a,9,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,4bR,6R,8R,8aS,10aS)-8-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1,4a,6-trimethyl-10-oxo-3,4,4b,5,6,7,8,8a,9,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 58601691 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | methyl (1R,4aS,4bR,6R,8R,8aS,10aS)-8-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1,4a,6-trimethyl-10-oxo-3,4,4b,5,6,7,8,8a,9,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@@H]3C[C@@H](C)C[C@@H](OC(C)=O)[C@H]3CC(=O)[C@@H]21 |
| InChI | InChI=1S/C27H46O6Si/c1-16-11-20-19(22(12-16)32-17(2)28)13-21(29)23-26(20,6)14-18(15-27(23,7)24(30)31-8)33-34(9,10)25(3,4)5/h16,18-20,22-23H,11-15H2,1-10H3/t16-,18?,19+,20-,22-,23+,26+,27-/m1/s1 |
| InChIKey | BIZADCFNLFYPJL-XYKUUJBOSA-N |
| XLogP | 5.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|