C26H48O3Si — CID 58601695
(1R,4aS,4bR,6S,8R,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dideuterio-2-hydroxyethyl)-1,4a,6,8-tetramethyl-4,4b,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-3-one (PubChem CID 58601695) has the molecular formula C26H48O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is (1R,4aS,4bR,6S,8R,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dideuterio-2-hydroxyethyl)-1,4a,6,8-tetramethyl-4,4b,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-3-one.
| Compound Name | (1R,4aS,4bR,6S,8R,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dideuterio-2-hydroxyethyl)-1,4a,6,8-tetramethyl-4,4b,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-3-one |
|---|---|
| PubChem CID | 58601695 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (1R,4aS,4bR,6S,8R,8aR,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,2-dideuterio-2-hydroxyethyl)-1,4a,6,8-tetramethyl-4,4b,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-3-one |
| SMILES | [2H]C([2H])(O)C[C@]1(C)CC(=O)C[C@@]2(C)[C@@H]3C[C@@H](C)C[C@@H](C)[C@H]3C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C26H48O3Si/c1-17-12-18(2)20-14-22(29-30(8,9)24(3,4)5)23-25(6,10-11-27)15-19(28)16-26(23,7)21(20)13-17/h17-18,20-23,27H,10-16H2,1-9H3/t17-,18+,20+,21+,22-,23+,25+,26-/m0/s1/i11D2 |
| InChIKey | VVOWWLYXAXGROY-HKOHVAKPSA-N |
| XLogP | 6.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|