C38H35BN4 — CID 58601734
[3,5-bis(pyrrolo[2,3-b]pyridin-1-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 58601734) has the molecular formula C38H35BN4 and a molecular weight of 558.54 g/mol. Its IUPAC name is [3,5-bis(pyrrolo[2,3-b]pyridin-1-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [3,5-bis(pyrrolo[2,3-b]pyridin-1-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 58601734 |
| Molecular Formula | C38H35BN4 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | [3,5-bis(pyrrolo[2,3-b]pyridin-1-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2cc(-n3ccc4cccnc43)cc(-n3ccc4cccnc43)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C38H35BN4/c1-24-17-26(3)35(27(4)18-24)39(36-28(5)19-25(2)20-29(36)6)32-21-33(42-15-11-30-9-7-13-40-37(30)42)23-34(22-32)43-16-12-31-10-8-14-41-38(31)43/h7-23H,1-6H3 |
| InChIKey | XMADFTFRAONKNK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|