C15H18F8INO8S — CID 58601836
methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutane-1-carboxylate (PubChem CID 58601836) has the molecular formula C15H18F8INO8S and a molecular weight of 651.26 g/mol. Its IUPAC name is methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutane-1-carboxylate.
| Compound Name | methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 58601836 |
| Molecular Formula | C15H18F8INO8S |
| Molecular Weight | 651.26 g/mol |
| Exact Mass | 650.97 |
| IUPAC Name | methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethyl]sulfonyloxycyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)OC(C)(C)C)CC(OS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)I)C1 |
| InChI | InChI=1S/C15H18F8INO8S/c1-10(2,3)31-9(27)25-11(8(26)30-4)5-7(6-11)32-34(28,29)15(22,23)14(20,21)33-13(18,19)12(16,17)24/h7H,5-6H2,1-4H3,(H,25,27) |
| InChIKey | DDDAJQHDEFYVAK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|